C24H27ClN4O3S — CID 6876865
2-(3-chloro-N-methylsulfonylanilino)-N-[(E)-[1-(3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide (PubChem CID 6876865) has the molecular formula C24H27ClN4O3S and a molecular weight of 487.03 g/mol. Its IUPAC name is 2-(3-chloro-N-methylsulfonylanilino)-N-[(E)-[1-(3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide.
| Compound Name | 2-(3-chloro-N-methylsulfonylanilino)-N-[(E)-[1-(3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 6876865 |
| Molecular Formula | C24H27ClN4O3S |
| Molecular Weight | 487.03 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | 2-(3-chloro-N-methylsulfonylanilino)-N-[(E)-[1-(3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide |
| SMILES | Cc1cc(C)cc(-n2c(C)cc(/C=N/NC(=O)CN(c3cccc(Cl)c3)S(C)(=O)=O)c2C)c1 |
| InChI | InChI=1S/C24H27ClN4O3S/c1-16-9-17(2)11-23(10-16)29-18(3)12-20(19(29)4)14-26-27-24(30)15-28(33(5,31)32)22-8-6-7-21(25)13-22/h6-14H,15H2,1-5H3,(H,27,30)/b26-14+ |
| InChIKey | JPUJICFTJHYAHO-VULFUBBASA-N |
| XLogP | 4.28 |
| TPSA | 83.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.03 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|