C22H22Cl2N4O3S — CID 126191783
2-(3-chloro-N-methylsulfonylanilino)-N-[(Z)-[1-(2-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide (PubChem CID 126191783) has the molecular formula C22H22Cl2N4O3S and a molecular weight of 493.42 g/mol. Its IUPAC name is 2-(3-chloro-N-methylsulfonylanilino)-N-[(Z)-[1-(2-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide.
| Compound Name | 2-(3-chloro-N-methylsulfonylanilino)-N-[(Z)-[1-(2-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126191783 |
| Molecular Formula | C22H22Cl2N4O3S |
| Molecular Weight | 493.42 g/mol |
| Exact Mass | 492.08 |
| IUPAC Name | 2-(3-chloro-N-methylsulfonylanilino)-N-[(Z)-[1-(2-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide |
| SMILES | Cc1cc(/C=N\NC(=O)CN(c2cccc(Cl)c2)S(C)(=O)=O)c(C)n1-c1ccccc1Cl |
| InChI | InChI=1S/C22H22Cl2N4O3S/c1-15-11-17(16(2)28(15)21-10-5-4-9-20(21)24)13-25-26-22(29)14-27(32(3,30)31)19-8-6-7-18(23)12-19/h4-13H,14H2,1-3H3,(H,26,29)/b25-13- |
| InChIKey | MCSPADAHCYRZGR-MXAYSNPKSA-N |
| XLogP | 4.32 |
| TPSA | 83.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.42 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|