C22H20Cl4N4O3S — CID 126032799
2-(2,5-dichloro-N-methylsulfonylanilino)-N-[(Z)-[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide (PubChem CID 126032799) has the molecular formula C22H20Cl4N4O3S and a molecular weight of 562.31 g/mol. Its IUPAC name is 2-(2,5-dichloro-N-methylsulfonylanilino)-N-[(Z)-[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide.
| Compound Name | 2-(2,5-dichloro-N-methylsulfonylanilino)-N-[(Z)-[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126032799 |
| Molecular Formula | C22H20Cl4N4O3S |
| Molecular Weight | 562.31 g/mol |
| Exact Mass | 560.00 |
| IUPAC Name | 2-(2,5-dichloro-N-methylsulfonylanilino)-N-[(Z)-[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide |
| SMILES | Cc1cc(/C=N\NC(=O)CN(c2cc(Cl)ccc2Cl)S(C)(=O)=O)c(C)n1-c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C22H20Cl4N4O3S/c1-13-9-15(14(2)30(13)19-6-4-5-18(25)22(19)26)11-27-28-21(31)12-29(34(3,32)33)20-10-16(23)7-8-17(20)24/h4-11H,12H2,1-3H3,(H,28,31)/b27-11- |
| InChIKey | KSVAMVBUBCHPOY-BCHBDCPOSA-N |
| XLogP | 5.62 |
| TPSA | 83.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.31 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|