C26H32N4O5S — CID 6280545
2-(2,5-dimethoxy-N-methylsulfonylanilino)-N-[(Z)-[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide (PubChem CID 6280545) has the molecular formula C26H32N4O5S and a molecular weight of 512.63 g/mol. Its IUPAC name is 2-(2,5-dimethoxy-N-methylsulfonylanilino)-N-[(Z)-[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide.
| Compound Name | 2-(2,5-dimethoxy-N-methylsulfonylanilino)-N-[(Z)-[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 6280545 |
| Molecular Formula | C26H32N4O5S |
| Molecular Weight | 512.63 g/mol |
| Exact Mass | 512.21 |
| IUPAC Name | 2-(2,5-dimethoxy-N-methylsulfonylanilino)-N-[(Z)-[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide |
| SMILES | COc1ccc(OC)c(N(CC(=O)N/N=C\c2cc(C)n(-c3ccc(C)c(C)c3)c2C)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C26H32N4O5S/c1-17-8-9-22(12-18(17)2)30-19(3)13-21(20(30)4)15-27-28-26(31)16-29(36(7,32)33)24-14-23(34-5)10-11-25(24)35-6/h8-15H,16H2,1-7H3,(H,28,31)/b27-15- |
| InChIKey | GDXPPCKJOXYYFN-DICXZTSXSA-N |
| XLogP | 3.64 |
| TPSA | 102.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.63 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|