C25H30N4O4S — CID 94837733
N-[(Z)-[1-(2,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-(4-methoxy-N-methylsulfonylanilino)acetamide (PubChem CID 94837733) has the molecular formula C25H30N4O4S and a molecular weight of 482.61 g/mol. Its IUPAC name is N-[(Z)-[1-(2,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-(4-methoxy-N-methylsulfonylanilino)acetamide.
| Compound Name | N-[(Z)-[1-(2,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-(4-methoxy-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 94837733 |
| Molecular Formula | C25H30N4O4S |
| Molecular Weight | 482.61 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | N-[(Z)-[1-(2,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-(4-methoxy-N-methylsulfonylanilino)acetamide |
| SMILES | COc1ccc(N(CC(=O)N/N=C\c2cc(C)n(-c3ccc(C)cc3C)c2C)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C25H30N4O4S/c1-17-7-12-24(18(2)13-17)29-19(3)14-21(20(29)4)15-26-27-25(30)16-28(34(6,31)32)22-8-10-23(33-5)11-9-22/h7-15H,16H2,1-6H3,(H,27,30)/b26-15- |
| InChIKey | LKLVLVOSSQCGIA-YSMPRRRNSA-N |
| XLogP | 3.64 |
| TPSA | 93.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.61 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|