C25H29N3O2S — CID 3128310
N-[[1-(2,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-[(4-methoxyphenyl)methylsulfanyl]acetamide (PubChem CID 3128310) has the molecular formula C25H29N3O2S and a molecular weight of 435.59 g/mol. Its IUPAC name is N-[[1-(2,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-[(4-methoxyphenyl)methylsulfanyl]acetamide.
| Compound Name | N-[[1-(2,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-[(4-methoxyphenyl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 3128310 |
| Molecular Formula | C25H29N3O2S |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | N-[[1-(2,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-[(4-methoxyphenyl)methylsulfanyl]acetamide |
| SMILES | COc1ccc(CSCC(=O)NN=Cc2cc(C)n(-c3ccc(C)cc3C)c2C)cc1 |
| InChI | InChI=1S/C25H29N3O2S/c1-17-6-11-24(18(2)12-17)28-19(3)13-22(20(28)4)14-26-27-25(29)16-31-15-21-7-9-23(30-5)10-8-21/h6-14H,15-16H2,1-5H3,(H,27,29) |
| InChIKey | KPDMJWFGUHTRNM-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|