C24H25Cl2N3OS — CID 92850653
N-[(Z)-[1-(2,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-[(3,5-dimethylphenyl)methylsulfanyl]acetamide (PubChem CID 92850653) has the molecular formula C24H25Cl2N3OS and a molecular weight of 474.46 g/mol. Its IUPAC name is N-[(Z)-[1-(2,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-[(3,5-dimethylphenyl)methylsulfanyl]acetamide.
| Compound Name | N-[(Z)-[1-(2,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-[(3,5-dimethylphenyl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 92850653 |
| Molecular Formula | C24H25Cl2N3OS |
| Molecular Weight | 474.46 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | N-[(Z)-[1-(2,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-[(3,5-dimethylphenyl)methylsulfanyl]acetamide |
| SMILES | Cc1cc(C)cc(CSCC(=O)N/N=C\c2cc(C)n(-c3cc(Cl)ccc3Cl)c2C)c1 |
| InChI | InChI=1S/C24H25Cl2N3OS/c1-15-7-16(2)9-19(8-15)13-31-14-24(30)28-27-12-20-10-17(3)29(18(20)4)23-11-21(25)5-6-22(23)26/h5-12H,13-14H2,1-4H3,(H,28,30)/b27-12- |
| InChIKey | NDMOYNASYQWYOK-PPDIBHTLSA-N |
| XLogP | 6.40 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.46 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|