C21H17Cl3N4O2 — CID 132951169
N-(4-chlorophenyl)-N'-[[1-(2,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]oxamide (PubChem CID 132951169) has the molecular formula C21H17Cl3N4O2 and a molecular weight of 463.75 g/mol. Its IUPAC name is N-(4-chlorophenyl)-N'-[[1-(2,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]oxamide.
| Compound Name | N-(4-chlorophenyl)-N'-[[1-(2,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 132951169 |
| Molecular Formula | C21H17Cl3N4O2 |
| Molecular Weight | 463.75 g/mol |
| Exact Mass | 462.04 |
| IUPAC Name | N-(4-chlorophenyl)-N'-[[1-(2,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]oxamide |
| SMILES | Cc1cc(C=NNC(=O)C(=O)Nc2ccc(Cl)cc2)c(C)n1-c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C21H17Cl3N4O2/c1-12-9-14(13(2)28(12)19-10-16(23)5-8-18(19)24)11-25-27-21(30)20(29)26-17-6-3-15(22)4-7-17/h3-11H,1-2H3,(H,26,29)(H,27,30) |
| InChIKey | SHADEHKKCFRHTR-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 75.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.75 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|