C15H12Cl2F3N3O — CID 2312267
N-[[1-(2,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2,2,2-trifluoroacetamide (PubChem CID 2312267) has the molecular formula C15H12Cl2F3N3O and a molecular weight of 378.18 g/mol. Its IUPAC name is N-[[1-(2,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2,2,2-trifluoroacetamide.
| Compound Name | N-[[1-(2,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 2312267 |
| Molecular Formula | C15H12Cl2F3N3O |
| Molecular Weight | 378.18 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | N-[[1-(2,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2,2,2-trifluoroacetamide |
| SMILES | Cc1cc(C=NNC(=O)C(F)(F)F)c(C)n1-c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H12Cl2F3N3O/c1-8-5-10(7-21-22-14(24)15(18,19)20)9(2)23(8)13-6-11(16)3-4-12(13)17/h3-7H,1-2H3,(H,22,24) |
| InChIKey | RBBBDZFKDMIXBC-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.18 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|