C22H21Cl2N3O2 — CID 5443236
(2S)-N-[(Z)-[1-(2,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-methoxy-2-phenylacetamide (PubChem CID 5443236) has the molecular formula C22H21Cl2N3O2 and a molecular weight of 430.34 g/mol. Its IUPAC name is (2S)-N-[(Z)-[1-(2,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-methoxy-2-phenylacetamide.
| Compound Name | (2S)-N-[(Z)-[1-(2,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-methoxy-2-phenylacetamide |
|---|---|
| PubChem CID | 5443236 |
| Molecular Formula | C22H21Cl2N3O2 |
| Molecular Weight | 430.34 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | (2S)-N-[(Z)-[1-(2,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-methoxy-2-phenylacetamide |
| SMILES | CO[C@H](C(=O)N/N=C\c1cc(C)n(-c2cc(Cl)ccc2Cl)c1C)c1ccccc1 |
| InChI | InChI=1S/C22H21Cl2N3O2/c1-14-11-17(15(2)27(14)20-12-18(23)9-10-19(20)24)13-25-26-22(28)21(29-3)16-7-5-4-6-8-16/h4-13,21H,1-3H3,(H,26,28)/b25-13-/t21-/m0/s1 |
| InChIKey | LAUGCIUSYVWGQM-CLVGQAISSA-N |
| XLogP | 5.24 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.34 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|