C16H14Cl2N2O3 — CID 136909038
(2R)-N-[(Z)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-2-methoxy-2-phenylacetamide (PubChem CID 136909038) has the molecular formula C16H14Cl2N2O3 and a molecular weight of 353.21 g/mol. Its IUPAC name is (2R)-N-[(Z)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-2-methoxy-2-phenylacetamide.
| Compound Name | (2R)-N-[(Z)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-2-methoxy-2-phenylacetamide |
|---|---|
| PubChem CID | 136909038 |
| Molecular Formula | C16H14Cl2N2O3 |
| Molecular Weight | 353.21 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | (2R)-N-[(Z)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-2-methoxy-2-phenylacetamide |
| SMILES | CO[C@@H](C(=O)N/N=C\c1cc(Cl)cc(Cl)c1O)c1ccccc1 |
| InChI | InChI=1S/C16H14Cl2N2O3/c1-23-15(10-5-3-2-4-6-10)16(22)20-19-9-11-7-12(17)8-13(18)14(11)21/h2-9,15,21H,1H3,(H,20,22)/b19-9-/t15-/m1/s1 |
| InChIKey | MWMLLFWMZNUJON-HBFFOVPNSA-N |
| XLogP | 3.54 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.21 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|