C16H14N4O7 — CID 137206870
(2S)-N-[(2-hydroxy-3,5-dinitrophenyl)methylideneamino]-2-methoxy-2-phenylacetamide (PubChem CID 137206870) has the molecular formula C16H14N4O7 and a molecular weight of 374.31 g/mol. Its IUPAC name is (2S)-N-[(2-hydroxy-3,5-dinitrophenyl)methylideneamino]-2-methoxy-2-phenylacetamide.
| Compound Name | (2S)-N-[(2-hydroxy-3,5-dinitrophenyl)methylideneamino]-2-methoxy-2-phenylacetamide |
|---|---|
| PubChem CID | 137206870 |
| Molecular Formula | C16H14N4O7 |
| Molecular Weight | 374.31 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | (2S)-N-[(2-hydroxy-3,5-dinitrophenyl)methylideneamino]-2-methoxy-2-phenylacetamide |
| SMILES | CO[C@H](C(=O)NN=Cc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O)c1ccccc1 |
| InChI | InChI=1S/C16H14N4O7/c1-27-15(10-5-3-2-4-6-10)16(22)18-17-9-11-7-12(19(23)24)8-13(14(11)21)20(25)26/h2-9,15,21H,1H3,(H,18,22)/t15-/m0/s1 |
| InChIKey | KCSBBJXHICDJQW-HNNXBMFYSA-N |
| XLogP | 2.05 |
| TPSA | 157.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.31 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|