C13H9N5O7 — CID 136886764
2,4-dinitro-6-[(Z)-[(4-nitrophenyl)hydrazinylidene]methyl]phenol (PubChem CID 136886764) has the molecular formula C13H9N5O7 and a molecular weight of 347.24 g/mol. Its IUPAC name is 2,4-dinitro-6-[(Z)-[(4-nitrophenyl)hydrazinylidene]methyl]phenol.
| Compound Name | 2,4-dinitro-6-[(Z)-[(4-nitrophenyl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 136886764 |
| Molecular Formula | C13H9N5O7 |
| Molecular Weight | 347.24 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | 2,4-dinitro-6-[(Z)-[(4-nitrophenyl)hydrazinylidene]methyl]phenol |
| SMILES | O=[N+]([O-])c1ccc(N/N=C\c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2O)cc1 |
| InChI | InChI=1S/C13H9N5O7/c19-13-8(5-11(17(22)23)6-12(13)18(24)25)7-14-15-9-1-3-10(4-2-9)16(20)21/h1-7,15,19H/b14-7- |
| InChIKey | UOVSBXNJYUZRLO-AUWJEWJLSA-N |
| XLogP | 2.56 |
| TPSA | 174.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.24 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|