C12H9N5O5 — CID 135458967
2,4-dinitro-6-[(E)-(pyridin-2-ylhydrazinylidene)methyl]phenol (PubChem CID 135458967) has the molecular formula C12H9N5O5 and a molecular weight of 303.23 g/mol. Its IUPAC name is 2,4-dinitro-6-[(E)-(pyridin-2-ylhydrazinylidene)methyl]phenol.
| Compound Name | 2,4-dinitro-6-[(E)-(pyridin-2-ylhydrazinylidene)methyl]phenol |
|---|---|
| PubChem CID | 135458967 |
| Molecular Formula | C12H9N5O5 |
| Molecular Weight | 303.23 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | 2,4-dinitro-6-[(E)-(pyridin-2-ylhydrazinylidene)methyl]phenol |
| SMILES | O=[N+]([O-])c1cc(/C=N/Nc2ccccn2)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H9N5O5/c18-12-8(7-14-15-11-3-1-2-4-13-11)5-9(16(19)20)6-10(12)17(21)22/h1-7,18H,(H,13,15)/b14-7+ |
| InChIKey | MRMSITJFCDXBLY-VGOFMYFVSA-N |
| XLogP | 2.05 |
| TPSA | 143.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.23 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|