C18H22N4O4 — CID 110842592
N-[(5-nitro-2,4-dipropoxyphenyl)methylideneamino]pyridin-2-amine (PubChem CID 110842592) has the molecular formula C18H22N4O4 and a molecular weight of 358.40 g/mol. Its IUPAC name is N-[(5-nitro-2,4-dipropoxyphenyl)methylideneamino]pyridin-2-amine.
| Compound Name | N-[(5-nitro-2,4-dipropoxyphenyl)methylideneamino]pyridin-2-amine |
|---|---|
| PubChem CID | 110842592 |
| Molecular Formula | C18H22N4O4 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | N-[(5-nitro-2,4-dipropoxyphenyl)methylideneamino]pyridin-2-amine |
| SMILES | CCCOc1cc(OCCC)c([N+](=O)[O-])cc1C=NNc1ccccn1 |
| InChI | InChI=1S/C18H22N4O4/c1-3-9-25-16-12-17(26-10-4-2)15(22(23)24)11-14(16)13-20-21-18-7-5-6-8-19-18/h5-8,11-13H,3-4,9-10H2,1-2H3,(H,19,21) |
| InChIKey | RHLFJRVLOHUKEI-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 98.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|