C17H21N3O2 — CID 84932002
N-[(3-ethoxy-4-propoxyphenyl)methylideneamino]pyridin-2-amine (PubChem CID 84932002) has the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. Its IUPAC name is N-[(3-ethoxy-4-propoxyphenyl)methylideneamino]pyridin-2-amine.
| Compound Name | N-[(3-ethoxy-4-propoxyphenyl)methylideneamino]pyridin-2-amine |
|---|---|
| PubChem CID | 84932002 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | N-[(3-ethoxy-4-propoxyphenyl)methylideneamino]pyridin-2-amine |
| SMILES | CCCOc1ccc(C=NNc2ccccn2)cc1OCC |
| InChI | InChI=1S/C17H21N3O2/c1-3-11-22-15-9-8-14(12-16(15)21-4-2)13-19-20-17-7-5-6-10-18-17/h5-10,12-13H,3-4,11H2,1-2H3,(H,18,20) |
| InChIKey | HZJCEABIGHQNHO-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 55.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|