C17H18N2O6S — CID 110518805
(NZ)-N-[(2,4-diethoxy-5-nitrophenyl)methylidene]benzenesulfonamide (PubChem CID 110518805) has the molecular formula C17H18N2O6S and a molecular weight of 378.41 g/mol. Its IUPAC name is (NZ)-N-[(2,4-diethoxy-5-nitrophenyl)methylidene]benzenesulfonamide.
| Compound Name | (NZ)-N-[(2,4-diethoxy-5-nitrophenyl)methylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 110518805 |
| Molecular Formula | C17H18N2O6S |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | (NZ)-N-[(2,4-diethoxy-5-nitrophenyl)methylidene]benzenesulfonamide |
| SMILES | CCOc1cc(OCC)c([N+](=O)[O-])cc1/C=N\S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H18N2O6S/c1-3-24-16-11-17(25-4-2)15(19(20)21)10-13(16)12-18-26(22,23)14-8-6-5-7-9-14/h5-12H,3-4H2,1-2H3/b18-12- |
| InChIKey | FKTIMYWHFACMCK-PDGQHHTCSA-N |
| XLogP | 3.20 |
| TPSA | 108.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|