C18H18N4O7 — CID 110506678
N-[(E)-(2,4-diethoxy-5-nitrophenyl)methylideneamino]-4-nitrobenzamide (PubChem CID 110506678) has the molecular formula C18H18N4O7 and a molecular weight of 402.36 g/mol. Its IUPAC name is N-[(E)-(2,4-diethoxy-5-nitrophenyl)methylideneamino]-4-nitrobenzamide.
| Compound Name | N-[(E)-(2,4-diethoxy-5-nitrophenyl)methylideneamino]-4-nitrobenzamide |
|---|---|
| PubChem CID | 110506678 |
| Molecular Formula | C18H18N4O7 |
| Molecular Weight | 402.36 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | N-[(E)-(2,4-diethoxy-5-nitrophenyl)methylideneamino]-4-nitrobenzamide |
| SMILES | CCOc1cc(OCC)c([N+](=O)[O-])cc1/C=N/NC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H18N4O7/c1-3-28-16-10-17(29-4-2)15(22(26)27)9-13(16)11-19-20-18(23)12-5-7-14(8-6-12)21(24)25/h5-11H,3-4H2,1-2H3,(H,20,23)/b19-11+ |
| InChIKey | APSWMUIIBDDXRT-YBFXNURJSA-N |
| XLogP | 3.06 |
| TPSA | 146.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.36 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|