C16H14ClN3O4 — CID 5390798
4-chloro-N-[(Z)-(2-ethoxy-5-nitrophenyl)methylideneamino]benzamide (PubChem CID 5390798) has the molecular formula C16H14ClN3O4 and a molecular weight of 347.76 g/mol. Its IUPAC name is 4-chloro-N-[(Z)-(2-ethoxy-5-nitrophenyl)methylideneamino]benzamide.
| Compound Name | 4-chloro-N-[(Z)-(2-ethoxy-5-nitrophenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 5390798 |
| Molecular Formula | C16H14ClN3O4 |
| Molecular Weight | 347.76 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | 4-chloro-N-[(Z)-(2-ethoxy-5-nitrophenyl)methylideneamino]benzamide |
| SMILES | CCOc1ccc([N+](=O)[O-])cc1/C=N\NC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H14ClN3O4/c1-2-24-15-8-7-14(20(22)23)9-12(15)10-18-19-16(21)11-3-5-13(17)6-4-11/h3-10H,2H2,1H3,(H,19,21)/b18-10- |
| InChIKey | HKIIRKDQQVPGAA-ZDLGFXPLSA-N |
| XLogP | 3.41 |
| TPSA | 93.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.76 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|