C22H16ClN3O6 — CID 126223684
[2-[(E)-[(4-methoxybenzoyl)hydrazinylidene]methyl]-4-nitrophenyl] 4-chlorobenzoate (PubChem CID 126223684) has the molecular formula C22H16ClN3O6 and a molecular weight of 453.84 g/mol. Its IUPAC name is [2-[(E)-[(4-methoxybenzoyl)hydrazinylidene]methyl]-4-nitrophenyl] 4-chlorobenzoate.
| Compound Name | [2-[(E)-[(4-methoxybenzoyl)hydrazinylidene]methyl]-4-nitrophenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 126223684 |
| Molecular Formula | C22H16ClN3O6 |
| Molecular Weight | 453.84 g/mol |
| Exact Mass | 453.07 |
| IUPAC Name | [2-[(E)-[(4-methoxybenzoyl)hydrazinylidene]methyl]-4-nitrophenyl] 4-chlorobenzoate |
| SMILES | COc1ccc(C(=O)N/N=C/c2cc([N+](=O)[O-])ccc2OC(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C22H16ClN3O6/c1-31-19-9-4-14(5-10-19)21(27)25-24-13-16-12-18(26(29)30)8-11-20(16)32-22(28)15-2-6-17(23)7-3-15/h2-13H,1H3,(H,25,27)/b24-13+ |
| InChIKey | CLANSWQCXVXDME-ZMOGYAJESA-N |
| XLogP | 4.24 |
| TPSA | 120.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.84 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|