C21H14BrN3O5 — CID 126228047
[2-[(E)-(benzoylhydrazinylidene)methyl]-4-nitrophenyl] 4-bromobenzoate (PubChem CID 126228047) has the molecular formula C21H14BrN3O5 and a molecular weight of 468.26 g/mol. Its IUPAC name is [2-[(E)-(benzoylhydrazinylidene)methyl]-4-nitrophenyl] 4-bromobenzoate.
| Compound Name | [2-[(E)-(benzoylhydrazinylidene)methyl]-4-nitrophenyl] 4-bromobenzoate |
|---|---|
| PubChem CID | 126228047 |
| Molecular Formula | C21H14BrN3O5 |
| Molecular Weight | 468.26 g/mol |
| Exact Mass | 467.01 |
| IUPAC Name | [2-[(E)-(benzoylhydrazinylidene)methyl]-4-nitrophenyl] 4-bromobenzoate |
| SMILES | O=C(N/N=C/c1cc([N+](=O)[O-])ccc1OC(=O)c1ccc(Br)cc1)c1ccccc1 |
| InChI | InChI=1S/C21H14BrN3O5/c22-17-8-6-15(7-9-17)21(27)30-19-11-10-18(25(28)29)12-16(19)13-23-24-20(26)14-4-2-1-3-5-14/h1-13H,(H,24,26)/b23-13+ |
| InChIKey | BAKNOQGBUDLKGT-YDZHTSKRSA-N |
| XLogP | 4.34 |
| TPSA | 110.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.26 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|