C21H14N4O8 — CID 126229343
[2-[(E)-[(2-hydroxybenzoyl)hydrazinylidene]methyl]-4-nitrophenyl] 4-nitrobenzoate (PubChem CID 126229343) has the molecular formula C21H14N4O8 and a molecular weight of 450.36 g/mol. Its IUPAC name is [2-[(E)-[(2-hydroxybenzoyl)hydrazinylidene]methyl]-4-nitrophenyl] 4-nitrobenzoate.
| Compound Name | [2-[(E)-[(2-hydroxybenzoyl)hydrazinylidene]methyl]-4-nitrophenyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 126229343 |
| Molecular Formula | C21H14N4O8 |
| Molecular Weight | 450.36 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | [2-[(E)-[(2-hydroxybenzoyl)hydrazinylidene]methyl]-4-nitrophenyl] 4-nitrobenzoate |
| SMILES | O=C(Oc1ccc([N+](=O)[O-])cc1/C=N/NC(=O)c1ccccc1O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H14N4O8/c26-18-4-2-1-3-17(18)20(27)23-22-12-14-11-16(25(31)32)9-10-19(14)33-21(28)13-5-7-15(8-6-13)24(29)30/h1-12,26H,(H,23,27)/b22-12+ |
| InChIKey | HFJNUKNAFLCDCM-WSDLNYQXSA-N |
| XLogP | 3.19 |
| TPSA | 174.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.36 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|