C28H19ClN4O6 — CID 126231239
[2-[[[3-[(2-chlorobenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] 4-nitrobenzoate (PubChem CID 126231239) has the molecular formula C28H19ClN4O6 and a molecular weight of 542.94 g/mol. Its IUPAC name is [2-[[[3-[(2-chlorobenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] 4-nitrobenzoate.
| Compound Name | [2-[[[3-[(2-chlorobenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 126231239 |
| Molecular Formula | C28H19ClN4O6 |
| Molecular Weight | 542.94 g/mol |
| Exact Mass | 542.10 |
| IUPAC Name | [2-[[[3-[(2-chlorobenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] 4-nitrobenzoate |
| SMILES | O=C(NN=Cc1ccccc1OC(=O)c1ccc([N+](=O)[O-])cc1)c1cccc(NC(=O)c2ccccc2Cl)c1 |
| InChI | InChI=1S/C28H19ClN4O6/c29-24-10-3-2-9-23(24)27(35)31-21-8-5-7-19(16-21)26(34)32-30-17-20-6-1-4-11-25(20)39-28(36)18-12-14-22(15-13-18)33(37)38/h1-17H,(H,31,35)(H,32,34) |
| InChIKey | OCQBQCKVCMOFRJ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 140.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.94 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|