C29H22N4O6 — CID 126228407
[2-[[[3-[(4-nitrobenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] 4-methylbenzoate (PubChem CID 126228407) has the molecular formula C29H22N4O6 and a molecular weight of 522.52 g/mol. Its IUPAC name is [2-[[[3-[(4-nitrobenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] 4-methylbenzoate.
| Compound Name | [2-[[[3-[(4-nitrobenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 126228407 |
| Molecular Formula | C29H22N4O6 |
| Molecular Weight | 522.52 g/mol |
| Exact Mass | 522.15 |
| IUPAC Name | [2-[[[3-[(4-nitrobenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2ccccc2C=NNC(=O)c2cccc(NC(=O)c3ccc([N+](=O)[O-])cc3)c2)cc1 |
| InChI | InChI=1S/C29H22N4O6/c1-19-9-11-21(12-10-19)29(36)39-26-8-3-2-5-23(26)18-30-32-28(35)22-6-4-7-24(17-22)31-27(34)20-13-15-25(16-14-20)33(37)38/h2-18H,1H3,(H,31,34)(H,32,35) |
| InChIKey | BCBDCPKCTKPVSF-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 140.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.52 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|