C29H22BrN3O4 — CID 126232771
[4-bromo-2-[[[3-[(4-methylbenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] benzoate (PubChem CID 126232771) has the molecular formula C29H22BrN3O4 and a molecular weight of 556.42 g/mol. Its IUPAC name is [4-bromo-2-[[[3-[(4-methylbenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] benzoate.
| Compound Name | [4-bromo-2-[[[3-[(4-methylbenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] benzoate |
|---|---|
| PubChem CID | 126232771 |
| Molecular Formula | C29H22BrN3O4 |
| Molecular Weight | 556.42 g/mol |
| Exact Mass | 555.08 |
| IUPAC Name | [4-bromo-2-[[[3-[(4-methylbenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] benzoate |
| SMILES | Cc1ccc(C(=O)Nc2cccc(C(=O)NN=Cc3cc(Br)ccc3OC(=O)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C29H22BrN3O4/c1-19-10-12-20(13-11-19)27(34)32-25-9-5-8-22(17-25)28(35)33-31-18-23-16-24(30)14-15-26(23)37-29(36)21-6-3-2-4-7-21/h2-18H,1H3,(H,32,34)(H,33,35) |
| InChIKey | USILVTHHXATVMU-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.42 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|