C29H21Br2N3O4 — CID 126229766
[2-[[(3-benzamidobenzoyl)hydrazinylidene]methyl]-4,6-dibromophenyl] 4-methylbenzoate (PubChem CID 126229766) has the molecular formula C29H21Br2N3O4 and a molecular weight of 635.31 g/mol. Its IUPAC name is [2-[[(3-benzamidobenzoyl)hydrazinylidene]methyl]-4,6-dibromophenyl] 4-methylbenzoate.
| Compound Name | [2-[[(3-benzamidobenzoyl)hydrazinylidene]methyl]-4,6-dibromophenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 126229766 |
| Molecular Formula | C29H21Br2N3O4 |
| Molecular Weight | 635.31 g/mol |
| Exact Mass | 632.99 |
| IUPAC Name | [2-[[(3-benzamidobenzoyl)hydrazinylidene]methyl]-4,6-dibromophenyl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2c(Br)cc(Br)cc2C=NNC(=O)c2cccc(NC(=O)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C29H21Br2N3O4/c1-18-10-12-20(13-11-18)29(37)38-26-22(14-23(30)16-25(26)31)17-32-34-28(36)21-8-5-9-24(15-21)33-27(35)19-6-3-2-4-7-19/h2-17H,1H3,(H,33,35)(H,34,36) |
| InChIKey | GZYFIFCVZHREGX-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.31 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|