C30H21Br2N3O7 — CID 126228152
[2-[[[3-(1,3-benzodioxole-5-carbonylamino)benzoyl]hydrazinylidene]methyl]-4,6-dibromophenyl] 4-methoxybenzoate (PubChem CID 126228152) has the molecular formula C30H21Br2N3O7 and a molecular weight of 695.32 g/mol. Its IUPAC name is [2-[[[3-(1,3-benzodioxole-5-carbonylamino)benzoyl]hydrazinylidene]methyl]-4,6-dibromophenyl] 4-methoxybenzoate.
| Compound Name | [2-[[[3-(1,3-benzodioxole-5-carbonylamino)benzoyl]hydrazinylidene]methyl]-4,6-dibromophenyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 126228152 |
| Molecular Formula | C30H21Br2N3O7 |
| Molecular Weight | 695.32 g/mol |
| Exact Mass | 692.97 |
| IUPAC Name | [2-[[[3-(1,3-benzodioxole-5-carbonylamino)benzoyl]hydrazinylidene]methyl]-4,6-dibromophenyl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2c(Br)cc(Br)cc2C=NNC(=O)c2cccc(NC(=O)c3ccc4c(c3)OCO4)c2)cc1 |
| InChI | InChI=1S/C30H21Br2N3O7/c1-39-23-8-5-17(6-9-23)30(38)42-27-20(11-21(31)14-24(27)32)15-33-35-29(37)18-3-2-4-22(12-18)34-28(36)19-7-10-25-26(13-19)41-16-40-25/h2-15H,16H2,1H3,(H,34,36)(H,35,37) |
| InChIKey | BVXMNHRQSCBJRE-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 124.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.32 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|