C25H20Br2N2O8 — CID 4566974
[2-[(1,3-benzodioxole-5-carbonylhydrazinylidene)methyl]-4,6-dibromophenyl] 3,4,5-trimethoxybenzoate (PubChem CID 4566974) has the molecular formula C25H20Br2N2O8 and a molecular weight of 636.25 g/mol. Its IUPAC name is [2-[(1,3-benzodioxole-5-carbonylhydrazinylidene)methyl]-4,6-dibromophenyl] 3,4,5-trimethoxybenzoate.
| Compound Name | [2-[(1,3-benzodioxole-5-carbonylhydrazinylidene)methyl]-4,6-dibromophenyl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 4566974 |
| Molecular Formula | C25H20Br2N2O8 |
| Molecular Weight | 636.25 g/mol |
| Exact Mass | 633.96 |
| IUPAC Name | [2-[(1,3-benzodioxole-5-carbonylhydrazinylidene)methyl]-4,6-dibromophenyl] 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)Oc2c(Br)cc(Br)cc2C=NNC(=O)c2ccc3c(c2)OCO3)cc(OC)c1OC |
| InChI | InChI=1S/C25H20Br2N2O8/c1-32-20-8-14(9-21(33-2)23(20)34-3)25(31)37-22-15(6-16(26)10-17(22)27)11-28-29-24(30)13-4-5-18-19(7-13)36-12-35-18/h4-11H,12H2,1-3H3,(H,29,30) |
| InChIKey | VHOHQUGZKOLQST-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 113.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.25 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|