C22H24BrN3O6 — CID 3946047
N-[1-[2-[(3-bromo-4,5-dimethoxyphenyl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-1,3-benzodioxole-5-carboxamide (PubChem CID 3946047) has the molecular formula C22H24BrN3O6 and a molecular weight of 506.35 g/mol. Its IUPAC name is N-[1-[2-[(3-bromo-4,5-dimethoxyphenyl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[1-[2-[(3-bromo-4,5-dimethoxyphenyl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 3946047 |
| Molecular Formula | C22H24BrN3O6 |
| Molecular Weight | 506.35 g/mol |
| Exact Mass | 505.08 |
| IUPAC Name | N-[1-[2-[(3-bromo-4,5-dimethoxyphenyl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-1,3-benzodioxole-5-carboxamide |
| SMILES | COc1cc(C=NNC(=O)C(NC(=O)c2ccc3c(c2)OCO3)C(C)C)cc(Br)c1OC |
| InChI | InChI=1S/C22H24BrN3O6/c1-12(2)19(25-21(27)14-5-6-16-17(9-14)32-11-31-16)22(28)26-24-10-13-7-15(23)20(30-4)18(8-13)29-3/h5-10,12,19H,11H2,1-4H3,(H,25,27)(H,26,28) |
| InChIKey | WTPOBDQBVAHAHC-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.35 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|