C28H28BrN3O5 — CID 4317979
N-[1-[2-[[3-bromo-4-[(4-methylphenyl)methoxy]phenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-1,3-benzodioxole-5-carboxamide (PubChem CID 4317979) has the molecular formula C28H28BrN3O5 and a molecular weight of 566.45 g/mol. Its IUPAC name is N-[1-[2-[[3-bromo-4-[(4-methylphenyl)methoxy]phenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[1-[2-[[3-bromo-4-[(4-methylphenyl)methoxy]phenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 4317979 |
| Molecular Formula | C28H28BrN3O5 |
| Molecular Weight | 566.45 g/mol |
| Exact Mass | 565.12 |
| IUPAC Name | N-[1-[2-[[3-bromo-4-[(4-methylphenyl)methoxy]phenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-1,3-benzodioxole-5-carboxamide |
| SMILES | Cc1ccc(COc2ccc(C=NNC(=O)C(NC(=O)c3ccc4c(c3)OCO4)C(C)C)cc2Br)cc1 |
| InChI | InChI=1S/C28H28BrN3O5/c1-17(2)26(31-27(33)21-9-11-24-25(13-21)37-16-36-24)28(34)32-30-14-20-8-10-23(22(29)12-20)35-15-19-6-4-18(3)5-7-19/h4-14,17,26H,15-16H2,1-3H3,(H,31,33)(H,32,34) |
| InChIKey | KLAYGMQVAGZEDL-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.45 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|