C27H24BrCl2N3O5 — CID 3973792
N-[1-[2-[[3-bromo-4-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-1,3-benzodioxole-5-carboxamide (PubChem CID 3973792) has the molecular formula C27H24BrCl2N3O5 and a molecular weight of 621.32 g/mol. Its IUPAC name is N-[1-[2-[[3-bromo-4-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[1-[2-[[3-bromo-4-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 3973792 |
| Molecular Formula | C27H24BrCl2N3O5 |
| Molecular Weight | 621.32 g/mol |
| Exact Mass | 619.03 |
| IUPAC Name | N-[1-[2-[[3-bromo-4-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-1,3-benzodioxole-5-carboxamide |
| SMILES | CC(C)C(NC(=O)c1ccc2c(c1)OCO2)C(=O)NN=Cc1ccc(OCc2ccc(Cl)c(Cl)c2)c(Br)c1 |
| InChI | InChI=1S/C27H24BrCl2N3O5/c1-15(2)25(32-26(34)18-5-8-23-24(11-18)38-14-37-23)27(35)33-31-12-16-4-7-22(19(28)9-16)36-13-17-3-6-20(29)21(30)10-17/h3-12,15,25H,13-14H2,1-2H3,(H,32,34)(H,33,35) |
| InChIKey | YYMKRJONLJEYGV-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.32 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|