C27H23BrCl2N4O3 — CID 4223110
N-[1-[2-[[3-bromo-4-[(2-cyanophenyl)methoxy]phenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-3,4-dichlorobenzamide (PubChem CID 4223110) has the molecular formula C27H23BrCl2N4O3 and a molecular weight of 602.32 g/mol. Its IUPAC name is N-[1-[2-[[3-bromo-4-[(2-cyanophenyl)methoxy]phenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-3,4-dichlorobenzamide.
| Compound Name | N-[1-[2-[[3-bromo-4-[(2-cyanophenyl)methoxy]phenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-3,4-dichlorobenzamide |
|---|---|
| PubChem CID | 4223110 |
| Molecular Formula | C27H23BrCl2N4O3 |
| Molecular Weight | 602.32 g/mol |
| Exact Mass | 600.03 |
| IUPAC Name | N-[1-[2-[[3-bromo-4-[(2-cyanophenyl)methoxy]phenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-3,4-dichlorobenzamide |
| SMILES | CC(C)C(NC(=O)c1ccc(Cl)c(Cl)c1)C(=O)NN=Cc1ccc(OCc2ccccc2C#N)c(Br)c1 |
| InChI | InChI=1S/C27H23BrCl2N4O3/c1-16(2)25(33-26(35)18-8-9-22(29)23(30)12-18)27(36)34-32-14-17-7-10-24(21(28)11-17)37-15-20-6-4-3-5-19(20)13-31/h3-12,14,16,25H,15H2,1-2H3,(H,33,35)(H,34,36) |
| InChIKey | SZSSDQNIJVVRTL-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 103.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.32 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|