C29H22BrN3O2 — CID 126397284
N-[(E)-[3-bromo-4-[(2-cyanophenyl)methoxy]phenyl]methylideneamino]-2,2-diphenylacetamide (PubChem CID 126397284) has the molecular formula C29H22BrN3O2 and a molecular weight of 524.42 g/mol. Its IUPAC name is N-[(E)-[3-bromo-4-[(2-cyanophenyl)methoxy]phenyl]methylideneamino]-2,2-diphenylacetamide.
| Compound Name | N-[(E)-[3-bromo-4-[(2-cyanophenyl)methoxy]phenyl]methylideneamino]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 126397284 |
| Molecular Formula | C29H22BrN3O2 |
| Molecular Weight | 524.42 g/mol |
| Exact Mass | 523.09 |
| IUPAC Name | N-[(E)-[3-bromo-4-[(2-cyanophenyl)methoxy]phenyl]methylideneamino]-2,2-diphenylacetamide |
| SMILES | N#Cc1ccccc1COc1ccc(/C=N/NC(=O)C(c2ccccc2)c2ccccc2)cc1Br |
| InChI | InChI=1S/C29H22BrN3O2/c30-26-17-21(15-16-27(26)35-20-25-14-8-7-13-24(25)18-31)19-32-33-29(34)28(22-9-3-1-4-10-22)23-11-5-2-6-12-23/h1-17,19,28H,20H2,(H,33,34)/b32-19+ |
| InChIKey | ROSXGWJIJMJXLG-BIZUNTBRSA-N |
| XLogP | 6.18 |
| TPSA | 74.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.42 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|