C22H15Br2N3O3 — CID 126149177
5-bromo-N-[(Z)-[3-bromo-4-[(2-cyanophenyl)methoxy]phenyl]methylideneamino]-2-hydroxybenzamide (PubChem CID 126149177) has the molecular formula C22H15Br2N3O3 and a molecular weight of 529.19 g/mol. Its IUPAC name is 5-bromo-N-[(Z)-[3-bromo-4-[(2-cyanophenyl)methoxy]phenyl]methylideneamino]-2-hydroxybenzamide.
| Compound Name | 5-bromo-N-[(Z)-[3-bromo-4-[(2-cyanophenyl)methoxy]phenyl]methylideneamino]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 126149177 |
| Molecular Formula | C22H15Br2N3O3 |
| Molecular Weight | 529.19 g/mol |
| Exact Mass | 526.95 |
| IUPAC Name | 5-bromo-N-[(Z)-[3-bromo-4-[(2-cyanophenyl)methoxy]phenyl]methylideneamino]-2-hydroxybenzamide |
| SMILES | N#Cc1ccccc1COc1ccc(/C=N\NC(=O)c2cc(Br)ccc2O)cc1Br |
| InChI | InChI=1S/C22H15Br2N3O3/c23-17-6-7-20(28)18(10-17)22(29)27-26-12-14-5-8-21(19(24)9-14)30-13-16-4-2-1-3-15(16)11-25/h1-10,12,28H,13H2,(H,27,29)/b26-12- |
| InChIKey | DIUNFHHTCCWLIW-ZRGSRPPYSA-N |
| XLogP | 5.13 |
| TPSA | 94.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.19 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|