C22H14BrCl2N3O2 — CID 4535332
N-[[3-bromo-4-[(2-cyanophenyl)methoxy]phenyl]methylideneamino]-2,4-dichlorobenzamide (PubChem CID 4535332) has the molecular formula C22H14BrCl2N3O2 and a molecular weight of 503.18 g/mol. Its IUPAC name is N-[[3-bromo-4-[(2-cyanophenyl)methoxy]phenyl]methylideneamino]-2,4-dichlorobenzamide.
| Compound Name | N-[[3-bromo-4-[(2-cyanophenyl)methoxy]phenyl]methylideneamino]-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 4535332 |
| Molecular Formula | C22H14BrCl2N3O2 |
| Molecular Weight | 503.18 g/mol |
| Exact Mass | 500.96 |
| IUPAC Name | N-[[3-bromo-4-[(2-cyanophenyl)methoxy]phenyl]methylideneamino]-2,4-dichlorobenzamide |
| SMILES | N#Cc1ccccc1COc1ccc(C=NNC(=O)c2ccc(Cl)cc2Cl)cc1Br |
| InChI | InChI=1S/C22H14BrCl2N3O2/c23-19-9-14(12-27-28-22(29)18-7-6-17(24)10-20(18)25)5-8-21(19)30-13-16-4-2-1-3-15(16)11-26/h1-10,12H,13H2,(H,28,29) |
| InChIKey | JTUBNGLDUZTUOK-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 74.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.18 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|