C33H25BrN4O2 — CID 6065682
N-[(Z)-[3-bromo-4-[(2-cyanophenyl)methoxy]phenyl]methylideneamino]-4-(2-methyl-5-phenylpyrrol-1-yl)benzamide (PubChem CID 6065682) has the molecular formula C33H25BrN4O2 and a molecular weight of 589.49 g/mol. Its IUPAC name is N-[(Z)-[3-bromo-4-[(2-cyanophenyl)methoxy]phenyl]methylideneamino]-4-(2-methyl-5-phenylpyrrol-1-yl)benzamide.
| Compound Name | N-[(Z)-[3-bromo-4-[(2-cyanophenyl)methoxy]phenyl]methylideneamino]-4-(2-methyl-5-phenylpyrrol-1-yl)benzamide |
|---|---|
| PubChem CID | 6065682 |
| Molecular Formula | C33H25BrN4O2 |
| Molecular Weight | 589.49 g/mol |
| Exact Mass | 588.12 |
| IUPAC Name | N-[(Z)-[3-bromo-4-[(2-cyanophenyl)methoxy]phenyl]methylideneamino]-4-(2-methyl-5-phenylpyrrol-1-yl)benzamide |
| SMILES | Cc1ccc(-c2ccccc2)n1-c1ccc(C(=O)N/N=C\c2ccc(OCc3ccccc3C#N)c(Br)c2)cc1 |
| InChI | InChI=1S/C33H25BrN4O2/c1-23-11-17-31(25-7-3-2-4-8-25)38(23)29-15-13-26(14-16-29)33(39)37-36-21-24-12-18-32(30(34)19-24)40-22-28-10-6-5-9-27(28)20-35/h2-19,21H,22H2,1H3,(H,37,39)/b36-21- |
| InChIKey | QVNNKADVGYCKTC-IDWIKUEFSA-N |
| XLogP | 7.43 |
| TPSA | 79.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.49 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|