C37H27Br2N3O2 — CID 126192852
N-[(Z)-[4-[(2,4-dibromophenyl)methoxy]phenyl]methylideneamino]-4-(2,5-diphenylpyrrol-1-yl)benzamide (PubChem CID 126192852) has the molecular formula C37H27Br2N3O2 and a molecular weight of 705.45 g/mol. Its IUPAC name is N-[(Z)-[4-[(2,4-dibromophenyl)methoxy]phenyl]methylideneamino]-4-(2,5-diphenylpyrrol-1-yl)benzamide.
| Compound Name | N-[(Z)-[4-[(2,4-dibromophenyl)methoxy]phenyl]methylideneamino]-4-(2,5-diphenylpyrrol-1-yl)benzamide |
|---|---|
| PubChem CID | 126192852 |
| Molecular Formula | C37H27Br2N3O2 |
| Molecular Weight | 705.45 g/mol |
| Exact Mass | 703.05 |
| IUPAC Name | N-[(Z)-[4-[(2,4-dibromophenyl)methoxy]phenyl]methylideneamino]-4-(2,5-diphenylpyrrol-1-yl)benzamide |
| SMILES | O=C(N/N=C\c1ccc(OCc2ccc(Br)cc2Br)cc1)c1ccc(-n2c(-c3ccccc3)ccc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C37H27Br2N3O2/c38-31-16-13-30(34(39)23-31)25-44-33-19-11-26(12-20-33)24-40-41-37(43)29-14-17-32(18-15-29)42-35(27-7-3-1-4-8-27)21-22-36(42)28-9-5-2-6-10-28/h1-24H,25H2,(H,41,43)/b40-24- |
| InChIKey | FKTIXYLXZZQVRZ-FZSDHLTPSA-N |
| XLogP | 9.68 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.45 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|