C30H22ClN3O — CID 6882945
N-[(E)-(4-chlorophenyl)methylideneamino]-4-(2,5-diphenylpyrrol-1-yl)benzamide (PubChem CID 6882945) has the molecular formula C30H22ClN3O and a molecular weight of 475.98 g/mol. Its IUPAC name is N-[(E)-(4-chlorophenyl)methylideneamino]-4-(2,5-diphenylpyrrol-1-yl)benzamide.
| Compound Name | N-[(E)-(4-chlorophenyl)methylideneamino]-4-(2,5-diphenylpyrrol-1-yl)benzamide |
|---|---|
| PubChem CID | 6882945 |
| Molecular Formula | C30H22ClN3O |
| Molecular Weight | 475.98 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | N-[(E)-(4-chlorophenyl)methylideneamino]-4-(2,5-diphenylpyrrol-1-yl)benzamide |
| SMILES | O=C(N/N=C/c1ccc(Cl)cc1)c1ccc(-n2c(-c3ccccc3)ccc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C30H22ClN3O/c31-26-15-11-22(12-16-26)21-32-33-30(35)25-13-17-27(18-14-25)34-28(23-7-3-1-4-8-23)19-20-29(34)24-9-5-2-6-10-24/h1-21H,(H,33,35)/b32-21+ |
| InChIKey | VPMXIJNTAVFBRK-RUMWWMSVSA-N |
| XLogP | 7.23 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.98 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|