C41H31ClN4O — CID 124534113
N-[(Z)-[1-(4-chlorophenyl)-2,5-diphenylpyrrol-3-yl]methylideneamino]-4-(2-methyl-5-phenylpyrrol-1-yl)benzamide (PubChem CID 124534113) has the molecular formula C41H31ClN4O and a molecular weight of 631.18 g/mol. Its IUPAC name is N-[(Z)-[1-(4-chlorophenyl)-2,5-diphenylpyrrol-3-yl]methylideneamino]-4-(2-methyl-5-phenylpyrrol-1-yl)benzamide.
| Compound Name | N-[(Z)-[1-(4-chlorophenyl)-2,5-diphenylpyrrol-3-yl]methylideneamino]-4-(2-methyl-5-phenylpyrrol-1-yl)benzamide |
|---|---|
| PubChem CID | 124534113 |
| Molecular Formula | C41H31ClN4O |
| Molecular Weight | 631.18 g/mol |
| Exact Mass | 630.22 |
| IUPAC Name | N-[(Z)-[1-(4-chlorophenyl)-2,5-diphenylpyrrol-3-yl]methylideneamino]-4-(2-methyl-5-phenylpyrrol-1-yl)benzamide |
| SMILES | Cc1ccc(-c2ccccc2)n1-c1ccc(C(=O)N/N=C\c2cc(-c3ccccc3)n(-c3ccc(Cl)cc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C41H31ClN4O/c1-29-17-26-38(30-11-5-2-6-12-30)45(29)36-22-18-33(19-23-36)41(47)44-43-28-34-27-39(31-13-7-3-8-14-31)46(37-24-20-35(42)21-25-37)40(34)32-15-9-4-10-16-32/h2-28H,1H3,(H,44,47)/b43-28- |
| InChIKey | KQYTWJUJRZVSSF-MBMPTNJISA-N |
| XLogP | 9.99 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.18 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|