C31H24IN3O2 — CID 4195893
3-hydroxy-4-iodo-N-[[1-(4-methylphenyl)-2,5-diphenylpyrrol-3-yl]methylideneamino]benzamide (PubChem CID 4195893) has the molecular formula C31H24IN3O2 and a molecular weight of 597.46 g/mol. Its IUPAC name is 3-hydroxy-4-iodo-N-[[1-(4-methylphenyl)-2,5-diphenylpyrrol-3-yl]methylideneamino]benzamide.
| Compound Name | 3-hydroxy-4-iodo-N-[[1-(4-methylphenyl)-2,5-diphenylpyrrol-3-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 4195893 |
| Molecular Formula | C31H24IN3O2 |
| Molecular Weight | 597.46 g/mol |
| Exact Mass | 597.09 |
| IUPAC Name | 3-hydroxy-4-iodo-N-[[1-(4-methylphenyl)-2,5-diphenylpyrrol-3-yl]methylideneamino]benzamide |
| SMILES | Cc1ccc(-n2c(-c3ccccc3)cc(C=NNC(=O)c3ccc(I)c(O)c3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C31H24IN3O2/c1-21-12-15-26(16-13-21)35-28(22-8-4-2-5-9-22)18-25(30(35)23-10-6-3-7-11-23)20-33-34-31(37)24-14-17-27(32)29(36)19-24/h2-20,36H,1H3,(H,34,37) |
| InChIKey | JGBVYXBQZYABGV-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 66.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.46 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|