C30H20Br3N3O2 — CID 3973684
3,5-dibromo-N-[[1-(4-bromophenyl)-2,5-diphenylpyrrol-3-yl]methylideneamino]-2-hydroxybenzamide (PubChem CID 3973684) has the molecular formula C30H20Br3N3O2 and a molecular weight of 694.22 g/mol. Its IUPAC name is 3,5-dibromo-N-[[1-(4-bromophenyl)-2,5-diphenylpyrrol-3-yl]methylideneamino]-2-hydroxybenzamide.
| Compound Name | 3,5-dibromo-N-[[1-(4-bromophenyl)-2,5-diphenylpyrrol-3-yl]methylideneamino]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 3973684 |
| Molecular Formula | C30H20Br3N3O2 |
| Molecular Weight | 694.22 g/mol |
| Exact Mass | 690.91 |
| IUPAC Name | 3,5-dibromo-N-[[1-(4-bromophenyl)-2,5-diphenylpyrrol-3-yl]methylideneamino]-2-hydroxybenzamide |
| SMILES | O=C(NN=Cc1cc(-c2ccccc2)n(-c2ccc(Br)cc2)c1-c1ccccc1)c1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C30H20Br3N3O2/c31-22-11-13-24(14-12-22)36-27(19-7-3-1-4-8-19)15-21(28(36)20-9-5-2-6-10-20)18-34-35-30(38)25-16-23(32)17-26(33)29(25)37/h1-18,37H,(H,35,38) |
| InChIKey | ZWUWISYQELMCGU-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 66.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.22 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|