C29H21BrN4O2 — CID 3701081
N-[[1-(4-bromophenyl)-2,5-diphenylpyrrol-3-yl]methylideneamino]-4-nitroaniline (PubChem CID 3701081) has the molecular formula C29H21BrN4O2 and a molecular weight of 537.42 g/mol. Its IUPAC name is N-[[1-(4-bromophenyl)-2,5-diphenylpyrrol-3-yl]methylideneamino]-4-nitroaniline.
| Compound Name | N-[[1-(4-bromophenyl)-2,5-diphenylpyrrol-3-yl]methylideneamino]-4-nitroaniline |
|---|---|
| PubChem CID | 3701081 |
| Molecular Formula | C29H21BrN4O2 |
| Molecular Weight | 537.42 g/mol |
| Exact Mass | 536.08 |
| IUPAC Name | N-[[1-(4-bromophenyl)-2,5-diphenylpyrrol-3-yl]methylideneamino]-4-nitroaniline |
| SMILES | O=[N+]([O-])c1ccc(NN=Cc2cc(-c3ccccc3)n(-c3ccc(Br)cc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C29H21BrN4O2/c30-24-11-15-26(16-12-24)33-28(21-7-3-1-4-8-21)19-23(29(33)22-9-5-2-6-10-22)20-31-32-25-13-17-27(18-14-25)34(35)36/h1-20,32H |
| InChIKey | DIFKGOARGPRXGF-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 72.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.42 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|