C33H28N4O4 — CID 98112576
(4R)-4-hydroxy-N-[(Z)-[1-(4-nitrophenyl)-2,5-diphenylpyrrol-3-yl]methylideneamino]-4-phenylbutanamide (PubChem CID 98112576) has the molecular formula C33H28N4O4 and a molecular weight of 544.61 g/mol. Its IUPAC name is (4R)-4-hydroxy-N-[(Z)-[1-(4-nitrophenyl)-2,5-diphenylpyrrol-3-yl]methylideneamino]-4-phenylbutanamide.
| Compound Name | (4R)-4-hydroxy-N-[(Z)-[1-(4-nitrophenyl)-2,5-diphenylpyrrol-3-yl]methylideneamino]-4-phenylbutanamide |
|---|---|
| PubChem CID | 98112576 |
| Molecular Formula | C33H28N4O4 |
| Molecular Weight | 544.61 g/mol |
| Exact Mass | 544.21 |
| IUPAC Name | (4R)-4-hydroxy-N-[(Z)-[1-(4-nitrophenyl)-2,5-diphenylpyrrol-3-yl]methylideneamino]-4-phenylbutanamide |
| SMILES | O=C(CC[C@@H](O)c1ccccc1)N/N=C\c1cc(-c2ccccc2)n(-c2ccc([N+](=O)[O-])cc2)c1-c1ccccc1 |
| InChI | InChI=1S/C33H28N4O4/c38-31(25-12-6-2-7-13-25)20-21-32(39)35-34-23-27-22-30(24-10-4-1-5-11-24)36(33(27)26-14-8-3-9-15-26)28-16-18-29(19-17-28)37(40)41/h1-19,22-23,31,38H,20-21H2,(H,35,39)/b34-23-/t31-/m1/s1 |
| InChIKey | GQZLZKYIBVUTLZ-IVODXGOLSA-N |
| XLogP | 6.68 |
| TPSA | 109.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.61 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|