C29H20BrN3O2 — CID 124543894
1-[1-(4-bromophenyl)-2,5-diphenylpyrrol-3-yl]-N-(4-nitrophenyl)methanimine (PubChem CID 124543894) has the molecular formula C29H20BrN3O2 and a molecular weight of 522.40 g/mol. Its IUPAC name is 1-[1-(4-bromophenyl)-2,5-diphenylpyrrol-3-yl]-N-(4-nitrophenyl)methanimine.
| Compound Name | 1-[1-(4-bromophenyl)-2,5-diphenylpyrrol-3-yl]-N-(4-nitrophenyl)methanimine |
|---|---|
| PubChem CID | 124543894 |
| Molecular Formula | C29H20BrN3O2 |
| Molecular Weight | 522.40 g/mol |
| Exact Mass | 521.07 |
| IUPAC Name | 1-[1-(4-bromophenyl)-2,5-diphenylpyrrol-3-yl]-N-(4-nitrophenyl)methanimine |
| SMILES | O=[N+]([O-])c1ccc(/N=C/c2cc(-c3ccccc3)n(-c3ccc(Br)cc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C29H20BrN3O2/c30-24-11-15-26(16-12-24)32-28(21-7-3-1-4-8-21)19-23(29(32)22-9-5-2-6-10-22)20-31-25-13-17-27(18-14-25)33(34)35/h1-20H/b31-20+ |
| InChIKey | WSUNWWPPDOBAPR-AJBULDERSA-N |
| XLogP | 8.23 |
| TPSA | 60.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.40 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|