C31H23ClN2O — CID 94845697
1-[4-[[1-(4-chlorophenyl)-2,5-diphenylpyrrol-3-yl]methylideneamino]phenyl]ethanone (PubChem CID 94845697) has the molecular formula C31H23ClN2O and a molecular weight of 474.99 g/mol. Its IUPAC name is 1-[4-[[1-(4-chlorophenyl)-2,5-diphenylpyrrol-3-yl]methylideneamino]phenyl]ethanone.
| Compound Name | 1-[4-[[1-(4-chlorophenyl)-2,5-diphenylpyrrol-3-yl]methylideneamino]phenyl]ethanone |
|---|---|
| PubChem CID | 94845697 |
| Molecular Formula | C31H23ClN2O |
| Molecular Weight | 474.99 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | 1-[4-[[1-(4-chlorophenyl)-2,5-diphenylpyrrol-3-yl]methylideneamino]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(/N=C/c2cc(-c3ccccc3)n(-c3ccc(Cl)cc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C31H23ClN2O/c1-22(35)23-12-16-28(17-13-23)33-21-26-20-30(24-8-4-2-5-9-24)34(29-18-14-27(32)15-19-29)31(26)25-10-6-3-7-11-25/h2-21H,1H3/b33-21+ |
| InChIKey | UGNIEEOMNLYNPL-QNKGDIEWSA-N |
| XLogP | 8.42 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.99 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|