C27H19ClN2O2S — CID 96882231
(5E)-5-[[1-(4-chlorophenyl)-2,5-diphenylpyrrol-3-yl]methylidene]-3-methyl-1,3-thiazolidine-2,4-dione (PubChem CID 96882231) has the molecular formula C27H19ClN2O2S and a molecular weight of 470.98 g/mol. Its IUPAC name is (5E)-5-[[1-(4-chlorophenyl)-2,5-diphenylpyrrol-3-yl]methylidene]-3-methyl-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[1-(4-chlorophenyl)-2,5-diphenylpyrrol-3-yl]methylidene]-3-methyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 96882231 |
| Molecular Formula | C27H19ClN2O2S |
| Molecular Weight | 470.98 g/mol |
| Exact Mass | 470.09 |
| IUPAC Name | (5E)-5-[[1-(4-chlorophenyl)-2,5-diphenylpyrrol-3-yl]methylidene]-3-methyl-1,3-thiazolidine-2,4-dione |
| SMILES | CN1C(=O)S/C(=C/c2cc(-c3ccccc3)n(-c3ccc(Cl)cc3)c2-c2ccccc2)C1=O |
| InChI | InChI=1S/C27H19ClN2O2S/c1-29-26(31)24(33-27(29)32)17-20-16-23(18-8-4-2-5-9-18)30(22-14-12-21(28)13-15-22)25(20)19-10-6-3-7-11-19/h2-17H,1H3/b24-17+ |
| InChIKey | HRTSWOZMKHOCJR-JJIBRWJFSA-N |
| XLogP | 7.13 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.98 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|