C34H24ClN3O3 — CID 124533018
(5Z)-5-[[1-(4-chlorophenyl)-2,5-diphenylpyrrol-3-yl]methylidene]-1-methyl-3-phenyl-1,3-diazinane-2,4,6-trione (PubChem CID 124533018) has the molecular formula C34H24ClN3O3 and a molecular weight of 558.04 g/mol. Its IUPAC name is (5Z)-5-[[1-(4-chlorophenyl)-2,5-diphenylpyrrol-3-yl]methylidene]-1-methyl-3-phenyl-1,3-diazinane-2,4,6-trione.
| Compound Name | (5Z)-5-[[1-(4-chlorophenyl)-2,5-diphenylpyrrol-3-yl]methylidene]-1-methyl-3-phenyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 124533018 |
| Molecular Formula | C34H24ClN3O3 |
| Molecular Weight | 558.04 g/mol |
| Exact Mass | 557.15 |
| IUPAC Name | (5Z)-5-[[1-(4-chlorophenyl)-2,5-diphenylpyrrol-3-yl]methylidene]-1-methyl-3-phenyl-1,3-diazinane-2,4,6-trione |
| SMILES | CN1C(=O)/C(=C/c2cc(-c3ccccc3)n(-c3ccc(Cl)cc3)c2-c2ccccc2)C(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C34H24ClN3O3/c1-36-32(39)29(33(40)38(34(36)41)27-15-9-4-10-16-27)21-25-22-30(23-11-5-2-6-12-23)37(28-19-17-26(35)18-20-28)31(25)24-13-7-3-8-14-24/h2-22H,1H3/b29-21- |
| InChIKey | NGMBPUJOLUDKGT-ANYBSYGZSA-N |
| XLogP | 7.47 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.04 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|