C34H24ClN3O2S — CID 136859454
(5E)-5-[[1-(4-chlorophenyl)-2,5-diphenylpyrrol-3-yl]methylidene]-6-hydroxy-3-(3-methylphenyl)-2-sulfanylidenepyrimidin-4-one (PubChem CID 136859454) has the molecular formula C34H24ClN3O2S and a molecular weight of 574.11 g/mol. Its IUPAC name is (5E)-5-[[1-(4-chlorophenyl)-2,5-diphenylpyrrol-3-yl]methylidene]-6-hydroxy-3-(3-methylphenyl)-2-sulfanylidenepyrimidin-4-one.
| Compound Name | (5E)-5-[[1-(4-chlorophenyl)-2,5-diphenylpyrrol-3-yl]methylidene]-6-hydroxy-3-(3-methylphenyl)-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 136859454 |
| Molecular Formula | C34H24ClN3O2S |
| Molecular Weight | 574.11 g/mol |
| Exact Mass | 573.13 |
| IUPAC Name | (5E)-5-[[1-(4-chlorophenyl)-2,5-diphenylpyrrol-3-yl]methylidene]-6-hydroxy-3-(3-methylphenyl)-2-sulfanylidenepyrimidin-4-one |
| SMILES | Cc1cccc(N2C(=O)/C(=C/c3cc(-c4ccccc4)n(-c4ccc(Cl)cc4)c3-c3ccccc3)C(O)=NC2=S)c1 |
| InChI | InChI=1S/C34H24ClN3O2S/c1-22-9-8-14-28(19-22)38-33(40)29(32(39)36-34(38)41)20-25-21-30(23-10-4-2-5-11-23)37(27-17-15-26(35)16-18-27)31(25)24-12-6-3-7-13-24/h2-21H,1H3,(H,36,39,41)/b29-20+ |
| InChIKey | IRNKLPASICHGIX-ZTKZIYFRSA-N |
| XLogP | 8.44 |
| TPSA | 57.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.11 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|