C36H29N3O3 — CID 6373939
ethyl 4-[3-[(E)-(3-methyl-5-oxo-1-phenylpyrazol-4-ylidene)methyl]-2,5-diphenylpyrrol-1-yl]benzoate (PubChem CID 6373939) has the molecular formula C36H29N3O3 and a molecular weight of 551.65 g/mol. Its IUPAC name is ethyl 4-[3-[(E)-(3-methyl-5-oxo-1-phenylpyrazol-4-ylidene)methyl]-2,5-diphenylpyrrol-1-yl]benzoate.
| Compound Name | ethyl 4-[3-[(E)-(3-methyl-5-oxo-1-phenylpyrazol-4-ylidene)methyl]-2,5-diphenylpyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 6373939 |
| Molecular Formula | C36H29N3O3 |
| Molecular Weight | 551.65 g/mol |
| Exact Mass | 551.22 |
| IUPAC Name | ethyl 4-[3-[(E)-(3-methyl-5-oxo-1-phenylpyrazol-4-ylidene)methyl]-2,5-diphenylpyrrol-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-n2c(-c3ccccc3)cc(/C=C3/C(=O)N(c4ccccc4)N=C3C)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C36H29N3O3/c1-3-42-36(41)28-19-21-30(22-20-28)38-33(26-13-7-4-8-14-26)24-29(34(38)27-15-9-5-10-16-27)23-32-25(2)37-39(35(32)40)31-17-11-6-12-18-31/h4-24H,3H2,1-2H3/b32-23+ |
| InChIKey | GDXTXGPSYNXUES-AWSUPERCSA-N |
| XLogP | 7.79 |
| TPSA | 63.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.65 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|