C29H22N2O4 — CID 50885528
benzyl 3-[5-[(Z)-(3-methyl-5-oxo-1-phenylpyrazol-4-ylidene)methyl]furan-2-yl]benzoate (PubChem CID 50885528) has the molecular formula C29H22N2O4 and a molecular weight of 462.51 g/mol. Its IUPAC name is benzyl 3-[5-[(Z)-(3-methyl-5-oxo-1-phenylpyrazol-4-ylidene)methyl]furan-2-yl]benzoate.
| Compound Name | benzyl 3-[5-[(Z)-(3-methyl-5-oxo-1-phenylpyrazol-4-ylidene)methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 50885528 |
| Molecular Formula | C29H22N2O4 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | benzyl 3-[5-[(Z)-(3-methyl-5-oxo-1-phenylpyrazol-4-ylidene)methyl]furan-2-yl]benzoate |
| SMILES | CC1=NN(c2ccccc2)C(=O)/C1=C\c1ccc(-c2cccc(C(=O)OCc3ccccc3)c2)o1 |
| InChI | InChI=1S/C29H22N2O4/c1-20-26(28(32)31(30-20)24-13-6-3-7-14-24)18-25-15-16-27(35-25)22-11-8-12-23(17-22)29(33)34-19-21-9-4-2-5-10-21/h2-18H,19H2,1H3/b26-18- |
| InChIKey | XALJKAUOPGJNIL-ITYLOYPMSA-N |
| XLogP | 6.11 |
| TPSA | 72.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|